98-86-2 Acetophenone
| product Name |
Acetophenone |
| CAS No |
98-86-2 |
| Synonyms |
Methyl phenyl ketone; 1-Phenylethanone; alpha-Acetophenone; 1-Phenyl-1-ethanone; phenyl methyl ketone |
| Molecular Formula |
C8H8O |
| Molecular Weight |
120.15 |
| InChI |
InChI=1/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
| EINECS |
202-708-7 |
| Molecular Structure |
|
| Density |
1.0266 |
| Melting point |
19.6℃ |
| Boiling point |
202℃ |
| Refractive index |
1.5315-1.534 |
| Flash point |
77℃ |
| Water solubility |
5.5 g/L (20℃) |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R36:;
|
| Safety Description |
S26:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jamila |
| Telephone |
+86-13706477236 |
| Email |
info@xinhohang.com |
| Address |
Wanggao Economic Development Zone of Shouguang County of Weifang City in Shandong Province,China |
| Contact |
Mrs. Wang |
| Telephone |
+86-15726167122 |
| Email |
sales@zsscm.com.cn |
| Address |
No.316-6,3rd Floor,New Material Trading Center,Tianqiao Jinan250031,Shandong,China |
| Contact |
Xu Hongbin |
| Telephone |
+86-515-86111688;86221388;86098099 |
| Email |
sales@hongtaibiochem.com |
| Address |
271 Xiangyang West Road, Jianhu County, Jiangsu province |
| Telephone |
+86-418-8229899 |
| Email |
natj@china-fluoro.com |
| Address |
5, 7th Huagong Road, Fluorineindustry development zone (Yimatu Town,Fumeng County),Fuxin City, Liaoning Province, China |
| Telephone |
+86-21-52903022;52906901;62141057 |
| Email |
shengyuchem@263.net |
| Address |
Floor 13, 2052 N., Zhongshan North Road Shanghai China |